C20H29FIN5S — CID 111165484
N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111165484) has the molecular formula C20H29FIN5S and a molecular weight of 517.46 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111165484 |
| Molecular Formula | C20H29FIN5S |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc(C)cs1)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C20H28FN5S.HI/c1-3-22-20(23-10-4-5-19-24-16(2)15-27-19)26-13-11-25(12-14-26)18-8-6-17(21)7-9-18;/h6-9,15H,3-5,10-14H2,1-2H3,(H,22,23);1H |
| InChIKey | FVYZDHJARWIIFA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|