C21H31IN4S — CID 111725396
3-benzyl-N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111725396) has the molecular formula C21H31IN4S and a molecular weight of 498.48 g/mol. Its IUPAC name is 3-benzyl-N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-benzyl-N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111725396 |
| Molecular Formula | C21H31IN4S |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 3-benzyl-N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc(C)cs1)N1CCC(Cc2ccccc2)C1.I |
| InChI | InChI=1S/C21H30N4S.HI/c1-3-22-21(23-12-7-10-20-24-17(2)16-26-20)25-13-11-19(15-25)14-18-8-5-4-6-9-18;/h4-6,8-9,16,19H,3,7,10-15H2,1-2H3,(H,22,23);1H |
| InChIKey | WJQXXVKBUYYUOF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|