C17H30N4S — CID 111153921
N-ethyl-3,5-dimethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide (PubChem CID 111153921) has the molecular formula C17H30N4S and a molecular weight of 322.52 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-3,5-dimethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111153921 |
| Molecular Formula | C17H30N4S |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | N-ethyl-3,5-dimethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nc(C)cs1)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C17H30N4S/c1-5-18-17(21-10-13(2)9-14(3)11-21)19-8-6-7-16-20-15(4)12-22-16/h12-14H,5-11H2,1-4H3,(H,18,19) |
| InChIKey | YZKLBKRIUMNVNO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|