C21H30N4OS — CID 109427277
N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109427277) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427277 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-ethyl-N'-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-4-phenoxypiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nc(C)cs1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4OS/c1-3-22-21(23-13-7-10-20-24-17(2)16-27-20)25-14-11-19(12-15-25)26-18-8-5-4-6-9-18/h4-6,8-9,16,19H,3,7,10-15H2,1-2H3,(H,22,23) |
| InChIKey | JZTHTTKTSSCRLF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|