C20H27N3OS — CID 109426946
N-ethyl-4-phenoxy-N'-(2-thiophen-2-ylethyl)piperidine-1-carboximidamide (PubChem CID 109426946) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is N-ethyl-4-phenoxy-N'-(2-thiophen-2-ylethyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-phenoxy-N'-(2-thiophen-2-ylethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109426946 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-ethyl-4-phenoxy-N'-(2-thiophen-2-ylethyl)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cccs1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N3OS/c1-2-21-20(22-13-10-19-9-6-16-25-19)23-14-11-18(12-15-23)24-17-7-4-3-5-8-17/h3-9,16,18H,2,10-15H2,1H3,(H,21,22) |
| InChIKey | ZJYYRAGJGHYJIQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|