C21H31N5O2 — CID 109426886
N-ethyl-4-phenoxy-N'-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide (PubChem CID 109426886) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-ethyl-4-phenoxy-N'-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-phenoxy-N'-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109426886 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | N-ethyl-4-phenoxy-N'-[2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1nc(C(C)C)no1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N5O2/c1-4-22-21(23-13-10-19-24-20(16(2)3)25-28-19)26-14-11-18(12-15-26)27-17-8-6-5-7-9-17/h5-9,16,18H,4,10-15H2,1-3H3,(H,22,23) |
| InChIKey | FNFNZSJGIDUWHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|