C22H34N6O2 — CID 111132687
N-ethyl-4-(2-methoxyphenyl)-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111132687) has the molecular formula C22H34N6O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyphenyl)-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-methoxyphenyl)-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111132687 |
| Molecular Formula | C22H34N6O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | N-ethyl-4-(2-methoxyphenyl)-N'-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCc1nc(C(C)C)no1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H34N6O2/c1-5-23-22(24-12-8-11-20-25-21(17(2)3)26-30-20)28-15-13-27(14-16-28)18-9-6-7-10-19(18)29-4/h6-7,9-10,17H,5,8,11-16H2,1-4H3,(H,23,24) |
| InChIKey | PBIMCTPFTIYLPD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|