C19H33N5OS — CID 111727255
N-ethyl-N'-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111727255) has the molecular formula C19H33N5OS and a molecular weight of 379.57 g/mol. Its IUPAC name is N-ethyl-N'-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111727255 |
| Molecular Formula | C19H33N5OS |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | N-ethyl-N'-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCc1nc(C)cs1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C19H33N5OS/c1-3-20-19(21-8-5-4-6-18-22-16(2)15-26-18)24-9-7-17(14-24)23-10-12-25-13-11-23/h15,17H,3-14H2,1-2H3,(H,20,21) |
| InChIKey | RUYYBJWBKGOMPQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|