C20H26F2IN5OS — CID 109451318
N-[3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 109451318) has the molecular formula C20H26F2IN5OS and a molecular weight of 549.43 g/mol. Its IUPAC name is N-[3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109451318 |
| Molecular Formula | C20H26F2IN5OS |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | N-[3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1cccs1)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C20H25F2N5OS.HI/c1-23-20(25-8-3-7-24-19(28)18-4-2-13-29-18)27-11-9-26(10-12-27)17-14-15(21)5-6-16(17)22;/h2,4-6,13-14H,3,7-12H2,1H3,(H,23,25)(H,24,28);1H |
| InChIKey | LZKVZFLDFHUQRQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|