C22H27F2N5O2 — CID 109451341
N-[2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide (PubChem CID 109451341) has the molecular formula C22H27F2N5O2 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 109451341 |
| Molecular Formula | C22H27F2N5O2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(OC)cc1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C22H27F2N5O2/c1-25-22(27-10-9-26-21(30)16-3-6-18(31-2)7-4-16)29-13-11-28(12-14-29)20-15-17(23)5-8-19(20)24/h3-8,15H,9-14H2,1-2H3,(H,25,27)(H,26,30) |
| InChIKey | QSVDDQYTADYKPM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|