C21H28IN5O4 — CID 111166344
N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide;hydroiodide (PubChem CID 111166344) has the molecular formula C21H28IN5O4 and a molecular weight of 541.39 g/mol. Its IUPAC name is N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide;hydroiodide.
| Compound Name | N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111166344 |
| Molecular Formula | C21H28IN5O4 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]-4-methoxybenzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(OC)cc1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C21H27N5O4.HI/c1-22-21(24-10-9-23-19(27)16-5-7-17(29-2)8-6-16)26-13-11-25(12-14-26)20(28)18-4-3-15-30-18;/h3-8,15H,9-14H2,1-2H3,(H,22,24)(H,23,27);1H |
| InChIKey | JLJIHXVYDBASOI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|