C15H18F2N4 — CID 109450655
4-(2,5-difluorophenyl)-N'-methyl-N-prop-2-ynylpiperazine-1-carboximidamide (PubChem CID 109450655) has the molecular formula C15H18F2N4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methyl-N-prop-2-ynylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methyl-N-prop-2-ynylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109450655 |
| Molecular Formula | C15H18F2N4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methyl-N-prop-2-ynylpiperazine-1-carboximidamide |
| SMILES | C#CCN/C(=N\C)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C15H18F2N4/c1-3-6-19-15(18-2)21-9-7-20(8-10-21)14-11-12(16)4-5-13(14)17/h1,4-5,11H,6-10H2,2H3,(H,18,19) |
| InChIKey | JZZBWWLFXXTICL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|