C22H28F2N6 — CID 109451577
4-(2,5-difluorophenyl)-N'-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 109451577) has the molecular formula C22H28F2N6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451577 |
| Molecular Formula | C22H28F2N6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccnc(N2CCCC2)c1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C22H28F2N6/c1-25-22(27-16-17-6-7-26-21(14-17)29-8-2-3-9-29)30-12-10-28(11-13-30)20-15-18(23)4-5-19(20)24/h4-7,14-15H,2-3,8-13,16H2,1H3,(H,25,27) |
| InChIKey | VBQWATSXFSPVDS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|