C19H24F2IN5 — CID 109451416
4-(2,5-difluorophenyl)-N'-methyl-N-[(3-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109451416) has the molecular formula C19H24F2IN5 and a molecular weight of 487.34 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methyl-N-[(3-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[(3-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109451416 |
| Molecular Formula | C19H24F2IN5 |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[(3-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ncccc1C)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C19H23F2N5.HI/c1-14-4-3-7-23-17(14)13-24-19(22-2)26-10-8-25(9-11-26)18-12-15(20)5-6-16(18)21;/h3-7,12H,8-11,13H2,1-2H3,(H,22,24);1H |
| InChIKey | OSAWPXODLQGPIQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|