C20H26F2N6 — CID 109451613
4-(2,5-difluorophenyl)-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 109451613) has the molecular formula C20H26F2N6 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451613 |
| Molecular Formula | C20H26F2N6 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccnc1N(C)C)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H26F2N6/c1-23-20(25-14-15-5-4-8-24-19(15)26(2)3)28-11-9-27(10-12-28)18-13-16(21)6-7-17(18)22/h4-8,13H,9-12,14H2,1-3H3,(H,23,25) |
| InChIKey | HYJMUDVXMYTRAO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|