C21H27F2IN4O — CID 109451022
4-(2,5-difluorophenyl)-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 109451022) has the molecular formula C21H27F2IN4O and a molecular weight of 516.37 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109451022 |
| Molecular Formula | C21H27F2IN4O |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-[[4-(methoxymethyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(COC)cc1)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C21H26F2N4O.HI/c1-24-21(25-14-16-3-5-17(6-4-16)15-28-2)27-11-9-26(10-12-27)20-13-18(22)7-8-19(20)23;/h3-8,13H,9-12,14-15H2,1-2H3,(H,24,25);1H |
| InChIKey | OEGVKYWZZKYQJJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|