C21H33N5 — CID 109442861
N'-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109442861) has the molecular formula C21H33N5 and a molecular weight of 355.53 g/mol. Its IUPAC name is N'-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N'-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109442861 |
| Molecular Formula | C21H33N5 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | N'-methyl-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCc1ccnc(N2CCCCC2)c1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C21H33N5/c1-22-21(26-15-18-7-3-4-8-19(18)16-26)24-14-17-9-10-23-20(13-17)25-11-5-2-6-12-25/h9-10,13,18-19H,2-8,11-12,14-16H2,1H3,(H,22,24) |
| InChIKey | XSKFQQRWEOEUJC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|