C21H36N4O2S — CID 109448337
N'-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109448337) has the molecular formula C21H36N4O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is N'-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109448337 |
| Molecular Formula | C21H36N4O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | N'-methyl-N-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCc1nc(C)cs1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H36N4O2S/c1-17-16-28-20(24-17)8-3-5-11-23-21(22-2)25-12-9-18(10-13-25)27-15-19-7-4-6-14-26-19/h16,18-19H,3-15H2,1-2H3,(H,22,23) |
| InChIKey | ICAAXJFAZKQEJJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|