C21H41N3O2 — CID 109446797
N-(5,5-dimethylhexyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109446797) has the molecular formula C21H41N3O2 and a molecular weight of 367.58 g/mol. Its IUPAC name is N-(5,5-dimethylhexyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-(5,5-dimethylhexyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446797 |
| Molecular Formula | C21H41N3O2 |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | N-(5,5-dimethylhexyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCC(C)(C)C)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H41N3O2/c1-21(2,3)12-6-7-13-23-20(22-4)24-14-10-18(11-15-24)26-17-19-9-5-8-16-25-19/h18-19H,5-17H2,1-4H3,(H,22,23) |
| InChIKey | SLTFHHZMEYWZKT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|