C22H39F3N4O2 — CID 109447191
N'-methyl-4-(oxan-2-ylmethoxy)-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide (PubChem CID 109447191) has the molecular formula C22H39F3N4O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447191 |
| Molecular Formula | C22H39F3N4O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCC1CCN(CC(F)(F)F)CC1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C22H39F3N4O2/c1-26-21(27-10-5-18-6-11-28(12-7-18)17-22(23,24)25)29-13-8-19(9-14-29)31-16-20-4-2-3-15-30-20/h18-20H,2-17H2,1H3,(H,26,27) |
| InChIKey | DDCGYTYWNZRDIY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|