C15H28F2IN3O2 — CID 109448276
N-(2,2-difluoroethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448276) has the molecular formula C15H28F2IN3O2 and a molecular weight of 447.31 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(2,2-difluoroethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448276 |
| Molecular Formula | C15H28F2IN3O2 |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-(2,2-difluoroethyl)-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(F)F)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C15H27F2N3O2.HI/c1-18-15(19-10-14(16)17)20-7-5-12(6-8-20)22-11-13-4-2-3-9-21-13;/h12-14H,2-11H2,1H3,(H,18,19);1H |
| InChIKey | BAEOETZMJNZHRM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|