C21H41IN4O2 — CID 109447344
N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447344) has the molecular formula C21H41IN4O2 and a molecular weight of 508.49 g/mol. Its IUPAC name is N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447344 |
| Molecular Formula | C21H41IN4O2 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN(C(C)C)C1CC1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C21H40N4O2.HI/c1-17(2)25(18-7-8-18)14-11-23-21(22-3)24-12-9-19(10-13-24)27-16-20-6-4-5-15-26-20;/h17-20H,4-16H2,1-3H3,(H,22,23);1H |
| InChIKey | DGHAXSJBAMBTFL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|