C20H39IN4O4 — CID 109449672
tert-butyl N-[2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 109449672) has the molecular formula C20H39IN4O4 and a molecular weight of 526.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109449672 |
| Molecular Formula | C20H39IN4O4 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | tert-butyl N-[2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C20H38N4O4.HI/c1-20(2,3)28-19(25)23-11-10-22-18(21-4)24-12-8-16(9-13-24)27-15-17-7-5-6-14-26-17;/h16-17H,5-15H2,1-4H3,(H,21,22)(H,23,25);1H |
| InChIKey | VKIMSMRCIMBLOC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|