C19H37IN4O3 — CID 109446844
N-tert-butyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide (PubChem CID 109446844) has the molecular formula C19H37IN4O3 and a molecular weight of 496.43 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109446844 |
| Molecular Formula | C19H37IN4O3 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-tert-butyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C19H36N4O3.HI/c1-19(2,3)22-17(24)13-21-18(20-4)23-10-8-15(9-11-23)26-14-16-7-5-6-12-25-16;/h15-16H,5-14H2,1-4H3,(H,20,21)(H,22,24);1H |
| InChIKey | QBVRTFNKJCSPLP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|