C18H35N3O4S — CID 109447193
N'-methyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447193) has the molecular formula C18H35N3O4S and a molecular weight of 389.56 g/mol. Its IUPAC name is N'-methyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-methyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447193 |
| Molecular Formula | C18H35N3O4S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | N'-methyl-N-(2-methyl-2-methylsulfonylpropyl)-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)(C)S(C)(=O)=O)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C18H35N3O4S/c1-18(2,26(4,22)23)14-20-17(19-3)21-10-8-15(9-11-21)25-13-16-7-5-6-12-24-16/h15-16H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | TYFHGJVIZFYYKI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|