C21H42N4O2 — CID 109447389
N-[2-[di(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447389) has the molecular formula C21H42N4O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447389 |
| Molecular Formula | C21H42N4O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H42N4O2/c1-17(2)25(18(3)4)14-11-23-21(22-5)24-12-9-19(10-13-24)27-16-20-8-6-7-15-26-20/h17-20H,6-16H2,1-5H3,(H,22,23) |
| InChIKey | PZKHNKNHQYWLKC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|