C24H46N4O2 — CID 109448411
N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109448411) has the molecular formula C24H46N4O2 and a molecular weight of 422.66 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109448411 |
| Molecular Formula | C24H46N4O2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)butyl]-N'-methyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CC(C)CC(C)C1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C24H46N4O2/c1-20-16-21(2)18-27(17-20)12-6-5-11-26-24(25-3)28-13-9-22(10-14-28)30-19-23-8-4-7-15-29-23/h20-23H,4-19H2,1-3H3,(H,25,26) |
| InChIKey | IGOTYYPAASUABC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|