C18H32N4S — CID 109490282
N',3-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-propylpiperidine-1-carboximidamide (PubChem CID 109490282) has the molecular formula C18H32N4S and a molecular weight of 336.55 g/mol. Its IUPAC name is N',3-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-propylpiperidine-1-carboximidamide.
| Compound Name | N',3-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490282 |
| Molecular Formula | C18H32N4S |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | N',3-dimethyl-N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCCCc2nc(C)cs2)C1 |
| InChI | InChI=1S/C18H32N4S/c1-5-9-18(3)10-7-12-22(14-18)17(19-4)20-11-6-8-16-21-15(2)13-23-16/h13H,5-12,14H2,1-4H3,(H,19,20) |
| InChIKey | MGMSRYQWUKJCIA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|