C13H26F2IN3 — CID 109490573
N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 109490573) has the molecular formula C13H26F2IN3 and a molecular weight of 389.27 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490573 |
| Molecular Formula | C13H26F2IN3 |
| Molecular Weight | 389.27 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-N',3-dimethyl-3-propylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCC(F)F)C1.I |
| InChI | InChI=1S/C13H25F2N3.HI/c1-4-6-13(2)7-5-8-18(10-13)12(16-3)17-9-11(14)15;/h11H,4-10H2,1-3H3,(H,16,17);1H |
| InChIKey | VRMPADURCWGFMK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|