C20H42IN5 — CID 109490397
N',3-dimethyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-propylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 109490397) has the molecular formula C20H42IN5 and a molecular weight of 479.50 g/mol. Its IUPAC name is N',3-dimethyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-propylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N',3-dimethyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-propylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109490397 |
| Molecular Formula | C20H42IN5 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N',3-dimethyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-propylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCCCN2CCCN(C)CC2)C1.I |
| InChI | InChI=1S/C20H41N5.HI/c1-5-9-20(2)10-6-15-25(18-20)19(21-3)22-11-7-13-24-14-8-12-23(4)16-17-24;/h5-18H2,1-4H3,(H,21,22);1H |
| InChIKey | KPDSLZDUHMFJSY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|