C20H40IN5 — CID 111745235
N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide (PubChem CID 111745235) has the molecular formula C20H40IN5 and a molecular weight of 477.48 g/mol. Its IUPAC name is N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111745235 |
| Molecular Formula | C20H40IN5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-2-azaspiro[4.5]decane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCN1CCCN(C)CC1)N1CCC2(CCCCC2)C1.I |
| InChI | InChI=1S/C20H39N5.HI/c1-21-19(25-15-10-20(18-25)8-4-3-5-9-20)22-11-6-13-24-14-7-12-23(2)16-17-24;/h3-18H2,1-2H3,(H,21,22);1H |
| InChIKey | DYFSEWZEGIHCIQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|