C16H32N4O2S — CID 109490254
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide (PubChem CID 109490254) has the molecular formula C16H32N4O2S and a molecular weight of 344.53 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide.
| Compound Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109490254 |
| Molecular Formula | C16H32N4O2S |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N',3-dimethyl-3-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1(C)CCCN(/C(=N/C)NCCN2CCCS2(=O)=O)C1 |
| InChI | InChI=1S/C16H32N4O2S/c1-4-7-16(2)8-5-10-19(14-16)15(17-3)18-9-12-20-11-6-13-23(20,21)22/h4-14H2,1-3H3,(H,17,18) |
| InChIKey | HZFLVKJNOJKRTR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|