C18H28ClN3O — CID 111960653
N-[3-(4-chlorophenyl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide (PubChem CID 111960653) has the molecular formula C18H28ClN3O and a molecular weight of 337.89 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide.
| Compound Name | N-[3-(4-chlorophenyl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111960653 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-[3-(4-chlorophenyl)propyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCCCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H28ClN3O/c1-3-23-17-10-13-22(14-11-17)18(20-2)21-12-4-5-15-6-8-16(19)9-7-15/h6-9,17H,3-5,10-14H2,1-2H3,(H,20,21) |
| InChIKey | BLXQUQSHTQHEES-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|