C17H28ClIN4 — CID 111054522
1-tert-butyl-2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide (PubChem CID 111054522) has the molecular formula C17H28ClIN4 and a molecular weight of 450.80 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111054522 |
| Molecular Formula | C17H28ClIN4 |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 1-tert-butyl-2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]guanidine;hydroiodide |
| SMILES | CC(C)(C)N/C(N)=N/CC(c1cccc(Cl)c1)N1CCCC1.I |
| InChI | InChI=1S/C17H27ClN4.HI/c1-17(2,3)21-16(19)20-12-15(22-9-4-5-10-22)13-7-6-8-14(18)11-13;/h6-8,11,15H,4-5,9-10,12H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | RSUCASCGDYIGTO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|