C22H28ClIN4O2 — CID 111054554
2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide (PubChem CID 111054554) has the molecular formula C22H28ClIN4O2 and a molecular weight of 542.85 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111054554 |
| Molecular Formula | C22H28ClIN4O2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(c1cccc(Cl)c1)N1CCCC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H27ClN4O2.HI/c23-17-6-3-5-16(13-17)19(27-9-1-2-10-27)15-25-22(24)26-18-7-8-20-21(14-18)29-12-4-11-28-20;/h3,5-8,13-14,19H,1-2,4,9-12,15H2,(H3,24,25,26);1H |
| InChIKey | KLAIHCIDESRSDK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|