C12H16F2IN3O2 — CID 119151910
2-(2,2-difluoroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide (PubChem CID 119151910) has the molecular formula C12H16F2IN3O2 and a molecular weight of 399.18 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide.
| Compound Name | 2-(2,2-difluoroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151910 |
| Molecular Formula | C12H16F2IN3O2 |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(F)F)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H15F2N3O2.HI/c13-11(14)7-16-12(15)17-8-2-3-9-10(6-8)19-5-1-4-18-9;/h2-3,6,11H,1,4-5,7H2,(H3,15,16,17);1H |
| InChIKey | ZLBOGPBKIITGLS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|