C18H24N4O2S — CID 111028222
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine (PubChem CID 111028222) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 111028222 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-(dimethylamino)-2-thiophen-2-ylethyl]guanidine |
| SMILES | CN(C)C(C/N=C(\N)Nc1ccc2c(c1)OCCCO2)c1cccs1 |
| InChI | InChI=1S/C18H24N4O2S/c1-22(2)14(17-5-3-10-25-17)12-20-18(19)21-13-6-7-15-16(11-13)24-9-4-8-23-15/h3,5-7,10-11,14H,4,8-9,12H2,1-2H3,(H3,19,20,21) |
| InChIKey | KPYLTRJXLZFUBY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|