C17H22IN3O3S — CID 111823860
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111823860) has the molecular formula C17H22IN3O3S and a molecular weight of 475.35 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823860 |
| Molecular Formula | C17H22IN3O3S |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CC(O)(C/N=C(\N)Nc1ccc2c(c1)OCCCO2)c1cccs1.I |
| InChI | InChI=1S/C17H21N3O3S.HI/c1-17(21,15-4-2-9-24-15)11-19-16(18)20-12-5-6-13-14(10-12)23-8-3-7-22-13;/h2,4-6,9-10,21H,3,7-8,11H2,1H3,(H3,18,19,20);1H |
| InChIKey | ZYRQXDAGRPPHKZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|