C15H17F3IN3O2S — CID 111823846
2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111823846) has the molecular formula C15H17F3IN3O2S and a molecular weight of 487.29 g/mol. Its IUPAC name is 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823846 |
| Molecular Formula | C15H17F3IN3O2S |
| Molecular Weight | 487.29 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | CC(O)(C/N=C(\N)Nc1ccc(OC(F)(F)F)cc1)c1cccs1.I |
| InChI | InChI=1S/C15H16F3N3O2S.HI/c1-14(22,12-3-2-8-24-12)9-20-13(19)21-10-4-6-11(7-5-10)23-15(16,17)18;/h2-8,22H,9H2,1H3,(H3,19,20,21);1H |
| InChIKey | WHQKZYTZAMQCAK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|