C20H22IN3O2S — CID 111823844
2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(3-phenoxyphenyl)guanidine;hydroiodide (PubChem CID 111823844) has the molecular formula C20H22IN3O2S and a molecular weight of 495.39 g/mol. Its IUPAC name is 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(3-phenoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(3-phenoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823844 |
| Molecular Formula | C20H22IN3O2S |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 2-(2-hydroxy-2-thiophen-2-ylpropyl)-1-(3-phenoxyphenyl)guanidine;hydroiodide |
| SMILES | CC(O)(C/N=C(\N)Nc1cccc(Oc2ccccc2)c1)c1cccs1.I |
| InChI | InChI=1S/C20H21N3O2S.HI/c1-20(24,18-11-6-12-26-18)14-22-19(21)23-15-7-5-10-17(13-15)25-16-8-3-2-4-9-16;/h2-13,24H,14H2,1H3,(H3,21,22,23);1H |
| InChIKey | SYOINLMUYBBSSV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|