C14H16IN3O — CID 110912668
2-methyl-1-(3-phenoxyphenyl)guanidine;hydroiodide (PubChem CID 110912668) has the molecular formula C14H16IN3O and a molecular weight of 369.21 g/mol. Its IUPAC name is 2-methyl-1-(3-phenoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(3-phenoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110912668 |
| Molecular Formula | C14H16IN3O |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2-methyl-1-(3-phenoxyphenyl)guanidine;hydroiodide |
| SMILES | C/N=C(\N)Nc1cccc(Oc2ccccc2)c1.I |
| InChI | InChI=1S/C14H15N3O.HI/c1-16-14(15)17-11-6-5-9-13(10-11)18-12-7-3-2-4-8-12;/h2-10H,1H3,(H3,15,16,17);1H |
| InChIKey | FVQLLDFIDPHYED-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|