C22H23N3O2 — CID 111823533
2-(2-hydroxy-2-phenylpropyl)-1-(3-phenoxyphenyl)guanidine (PubChem CID 111823533) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-(2-hydroxy-2-phenylpropyl)-1-(3-phenoxyphenyl)guanidine.
| Compound Name | 2-(2-hydroxy-2-phenylpropyl)-1-(3-phenoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111823533 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-(2-hydroxy-2-phenylpropyl)-1-(3-phenoxyphenyl)guanidine |
| SMILES | CC(O)(C/N=C(\N)Nc1cccc(Oc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O2/c1-22(26,17-9-4-2-5-10-17)16-24-21(23)25-18-11-8-14-20(15-18)27-19-12-6-3-7-13-19/h2-15,26H,16H2,1H3,(H3,23,24,25) |
| InChIKey | LXIBGDQVKKRUQT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|