C22H24BrN3O3 — CID 167756826
2-(2-hydroxy-3-phenoxypropyl)-1-(3-phenoxyphenyl)guanidine;hydrobromide (PubChem CID 167756826) has the molecular formula C22H24BrN3O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is 2-(2-hydroxy-3-phenoxypropyl)-1-(3-phenoxyphenyl)guanidine;hydrobromide.
| Compound Name | 2-(2-hydroxy-3-phenoxypropyl)-1-(3-phenoxyphenyl)guanidine;hydrobromide |
|---|---|
| PubChem CID | 167756826 |
| Molecular Formula | C22H24BrN3O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-(2-hydroxy-3-phenoxypropyl)-1-(3-phenoxyphenyl)guanidine;hydrobromide |
| SMILES | Br.N/C(=N\CC(O)COc1ccccc1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H23N3O3.BrH/c23-22(24-15-18(26)16-27-19-9-3-1-4-10-19)25-17-8-7-13-21(14-17)28-20-11-5-2-6-12-20;/h1-14,18,26H,15-16H2,(H3,23,24,25);1H |
| InChIKey | IWOVVIOKWVNYDC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|