C18H20F3N3O3 — CID 111082657
2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-(3-methoxyphenyl)guanidine (PubChem CID 111082657) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-(3-methoxyphenyl)guanidine.
| Compound Name | 2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-(3-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111082657 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-(3-methoxyphenyl)guanidine |
| SMILES | COc1cccc(N/C(N)=N/CC(O)COc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H20F3N3O3/c1-26-16-4-2-3-13(9-16)24-17(22)23-10-14(25)11-27-15-7-5-12(6-8-15)18(19,20)21/h2-9,14,25H,10-11H2,1H3,(H3,22,23,24) |
| InChIKey | STPSHUOSBGTKOS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|