C19H22F3N3O4 — CID 111082553
1-(3,4-dimethoxyphenyl)-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine (PubChem CID 111082553) has the molecular formula C19H22F3N3O4 and a molecular weight of 413.40 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine |
|---|---|
| PubChem CID | 111082553 |
| Molecular Formula | C19H22F3N3O4 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC(O)COc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C19H22F3N3O4/c1-27-16-7-6-13(9-17(16)28-2)25-18(23)24-10-14(26)11-29-15-5-3-4-12(8-15)19(20,21)22/h3-9,14,26H,10-11H2,1-2H3,(H3,23,24,25) |
| InChIKey | DTPMPBUAZTYSTE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|