C18H18F3N3O4S — CID 1297891
1-(3,4-dimethoxyphenyl)-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]thiourea (PubChem CID 1297891) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 1297891 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)COc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C18H18F3N3O4S/c1-26-14-7-6-12(9-15(14)27-2)22-17(29)24-23-16(25)10-28-13-5-3-4-11(8-13)18(19,20)21/h3-9H,10H2,1-2H3,(H,23,25)(H2,22,24,29) |
| InChIKey | BUHNALMDFOCZSK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|