C17H20ClFIN3O3 — CID 111082642
1-(3-chloro-4-methoxyphenyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111082642) has the molecular formula C17H20ClFIN3O3 and a molecular weight of 495.72 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111082642 |
| Molecular Formula | C17H20ClFIN3O3 |
| Molecular Weight | 495.72 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[3-(4-fluorophenoxy)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CC(O)COc2ccc(F)cc2)cc1Cl.I |
| InChI | InChI=1S/C17H19ClFN3O3.HI/c1-24-16-7-4-12(8-15(16)18)22-17(20)21-9-13(23)10-25-14-5-2-11(19)3-6-14;/h2-8,13,23H,9-10H2,1H3,(H3,20,21,22);1H |
| InChIKey | JDKPHDHWIQZEHE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.72 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|