C20H25ClFIN4O2 — CID 111028117
1-(3-chloro-4-methoxyphenyl)-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide (PubChem CID 111028117) has the molecular formula C20H25ClFIN4O2 and a molecular weight of 534.80 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111028117 |
| Molecular Formula | C20H25ClFIN4O2 |
| Molecular Weight | 534.80 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CC(c2ccc(F)cc2)N2CCOCC2)cc1Cl.I |
| InChI | InChI=1S/C20H24ClFN4O2.HI/c1-27-19-7-6-16(12-17(19)21)25-20(23)24-13-18(26-8-10-28-11-9-26)14-2-4-15(22)5-3-14;/h2-7,12,18H,8-11,13H2,1H3,(H3,23,24,25);1H |
| InChIKey | FBWXRQASAXAUII-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|