C21H27ClN4O — CID 111087045
2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 111087045) has the molecular formula C21H27ClN4O and a molecular weight of 386.93 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111087045 |
| Molecular Formula | C21H27ClN4O |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CC(c2ccc(Cl)cc2)N2CCOCC2)cc1C |
| InChI | InChI=1S/C21H27ClN4O/c1-15-3-8-19(13-16(15)2)25-21(23)24-14-20(26-9-11-27-12-10-26)17-4-6-18(22)7-5-17/h3-8,13,20H,9-12,14H2,1-2H3,(H3,23,24,25) |
| InChIKey | PHWUEWFFAKZIDQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|