C23H32N4O3 — CID 111028252
2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(3,5-dimethylphenyl)guanidine (PubChem CID 111028252) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(3,5-dimethylphenyl)guanidine.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(3,5-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111028252 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-1-(3,5-dimethylphenyl)guanidine |
| SMILES | COc1ccc(C(C/N=C(\N)Nc2cc(C)cc(C)c2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H32N4O3/c1-16-11-17(2)13-19(12-16)26-23(24)25-15-20(27-7-9-30-10-8-27)18-5-6-21(28-3)22(14-18)29-4/h5-6,11-14,20H,7-10,15H2,1-4H3,(H3,24,25,26) |
| InChIKey | OTNNFEXEOAXPTF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|